C23H18N3O5S2- — CID 174905756
[[1-[3-[3-(cyanomethyl)phenyl]sulfonylphenyl]indol-6-yl]-methylamino] sulfite (PubChem CID 174905756) has the molecular formula C23H18N3O5S2- and a molecular weight of 480.55 g/mol. Its IUPAC name is [[1-[3-[3-(cyanomethyl)phenyl]sulfonylphenyl]indol-6-yl]-methylamino] sulfite.
| Compound Name | [[1-[3-[3-(cyanomethyl)phenyl]sulfonylphenyl]indol-6-yl]-methylamino] sulfite |
|---|---|
| PubChem CID | 174905756 |
| Molecular Formula | C23H18N3O5S2- |
| Molecular Weight | 480.55 g/mol |
| Exact Mass | 480.07 |
| IUPAC Name | [[1-[3-[3-(cyanomethyl)phenyl]sulfonylphenyl]indol-6-yl]-methylamino] sulfite |
| SMILES | CN(OS(=O)[O-])c1ccc2ccn(-c3cccc(S(=O)(=O)c4cccc(CC#N)c4)c3)c2c1 |
| InChI | InChI=1S/C23H19N3O5S2/c1-25(31-32(27)28)19-9-8-18-11-13-26(23(18)16-19)20-5-3-7-22(15-20)33(29,30)21-6-2-4-17(14-21)10-12-24/h2-9,11,13-16H,10H2,1H3,(H,27,28)/p-1 |
| InChIKey | GWXOXGQXBRBBHP-UHFFFAOYSA-M |
| XLogP | 3.69 |
| TPSA | 115.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.55 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|