C16H14F2NO2Ti- — CID 174393945
N-(2,4-difluorobenzene-3-id-1-yl)-N-(2-methoxyethyl)benzamide;titanium (PubChem CID 174393945) has the molecular formula C16H14F2NO2Ti- and a molecular weight of 338.16 g/mol. Its IUPAC name is N-(2,4-difluorobenzene-3-id-1-yl)-N-(2-methoxyethyl)benzamide;titanium.
| Compound Name | N-(2,4-difluorobenzene-3-id-1-yl)-N-(2-methoxyethyl)benzamide;titanium |
|---|---|
| PubChem CID | 174393945 |
| Molecular Formula | C16H14F2NO2Ti- |
| Molecular Weight | 338.16 g/mol |
| Exact Mass | 338.05 |
| IUPAC Name | N-(2,4-difluorobenzene-3-id-1-yl)-N-(2-methoxyethyl)benzamide;titanium |
| SMILES | COCCN(C(=O)c1ccccc1)c1ccc(F)[c-]c1F.[Ti] |
| InChI | InChI=1S/C16H14F2NO2.Ti/c1-21-10-9-19(15-8-7-13(17)11-14(15)18)16(20)12-5-3-2-4-6-12;/h2-8H,9-10H2,1H3;/q-1; |
| InChIKey | CRUPNWZRJDGAAW-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.16 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|