C25H20Cl2N2O5S — CID 174394240
5-(3,5-dichlorophenyl)sulfanyl-1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid;1-phenylpyrazole-4-carbaldehyde (PubChem CID 174394240) has the molecular formula C25H20Cl2N2O5S and a molecular weight of 531.42 g/mol. Its IUPAC name is 5-(3,5-dichlorophenyl)sulfanyl-1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid;1-phenylpyrazole-4-carbaldehyde.
| Compound Name | 5-(3,5-dichlorophenyl)sulfanyl-1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid;1-phenylpyrazole-4-carbaldehyde |
|---|---|
| PubChem CID | 174394240 |
| Molecular Formula | C25H20Cl2N2O5S |
| Molecular Weight | 531.42 g/mol |
| Exact Mass | 530.05 |
| IUPAC Name | 5-(3,5-dichlorophenyl)sulfanyl-1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid;1-phenylpyrazole-4-carbaldehyde |
| SMILES | CC1(C(=O)O)C=C(Sc2cc(Cl)cc(Cl)c2)C=C(C(=O)O)C1.O=Cc1cnn(-c2ccccc2)c1 |
| InChI | InChI=1S/C15H12Cl2O4S.C10H8N2O/c1-15(14(20)21)6-8(13(18)19)2-12(7-15)22-11-4-9(16)3-10(17)5-11;13-8-9-6-11-12(7-9)10-4-2-1-3-5-10/h2-5,7H,6H2,1H3,(H,18,19)(H,20,21);1-8H |
| InChIKey | NAUSAZBCROBKSV-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.42 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|