About ethanebis(thioic S-acid);methyl 3-amino-2-methyl-3-oxopropanoate
ethanebis(thioic S-acid);methyl 3-amino-2-methyl-3-oxopropanoate (PubChem CID 174394363) has the molecular formula C7H11NO5S2
and a molecular weight of 253.30 g/mol. Its IUPAC name is ethanebis(thioic S-acid);methyl 3-amino-2-methyl-3-oxopropanoate.
Molecular Properties
| Compound Name | ethanebis(thioic S-acid);methyl 3-amino-2-methyl-3-oxopropanoate |
| PubChem CID | 174394363 |
| Molecular Formula | C7H11NO5S2 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.01 |
| IUPAC Name | ethanebis(thioic S-acid);methyl 3-amino-2-methyl-3-oxopropanoate |
| SMILES | COC(=O)C(C)C(N)=O.O=C(S)C(=O)S |
| InChI | InChI=1S/C5H9NO3.C2H2O2S2/c1-3(4(6)7)5(8)9-2;3-1(5)2(4)6/h3H,1-2H3,(H2,6,7);(H,3,5)(H,4,6) |
| InChIKey | HOHHVCSPALFVEG-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 103.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze ethanebis(thioic S-acid);methyl 3-amino-2-methyl-3-oxopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanebis(thioic S-acid);methyl 3-amino-2-methyl-3-oxopropanoate?
The IUPAC name of ethanebis(thioic S-acid);methyl 3-amino-2-methyl-3-oxopropanoate (CID 174394363) is ethanebis(thioic S-acid);methyl 3-amino-2-methyl-3-oxopropanoate.
What is the SMILES notation for ethanebis(thioic S-acid);methyl 3-amino-2-methyl-3-oxopropanoate?
The canonical SMILES for ethanebis(thioic S-acid);methyl 3-amino-2-methyl-3-oxopropanoate is COC(=O)C(C)C(N)=O.O=C(S)C(=O)S.
What is the InChIKey of ethanebis(thioic S-acid);methyl 3-amino-2-methyl-3-oxopropanoate?
The InChIKey is HOHHVCSPALFVEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO3.C2H2O2S2/c1-3(4(6)7)5(8)9-2;3-1(5)2(4)6/h3H,1-2H3,(H2,6,7);(H,3,5)(H,4,6).
What are the key properties of ethanebis(thioic S-acid);methyl 3-amino-2-methyl-3-oxopropanoate?
ethanebis(thioic S-acid);methyl 3-amino-2-methyl-3-oxopropanoate has a molecular weight of 253.30 g/mol, XLogP of -0.82, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethanebis(thioic S-acid);methyl 3-amino-2-methyl-3-oxopropanoate is sourced from PubChem (CID 174394363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).