C6H6F3N3O — CID 174395549
1-(1,2,2-trifluoroethyl)pyrazole-4-carboxamide (PubChem CID 174395549) has the molecular formula C6H6F3N3O and a molecular weight of 193.13 g/mol. Its IUPAC name is 1-(1,2,2-trifluoroethyl)pyrazole-4-carboxamide.
| Compound Name | 1-(1,2,2-trifluoroethyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 174395549 |
| Molecular Formula | C6H6F3N3O |
| Molecular Weight | 193.13 g/mol |
| Exact Mass | 193.05 |
| IUPAC Name | 1-(1,2,2-trifluoroethyl)pyrazole-4-carboxamide |
| SMILES | NC(=O)c1cnn(C(F)C(F)F)c1 |
| InChI | InChI=1S/C6H6F3N3O/c7-4(8)5(9)12-2-3(1-11-12)6(10)13/h1-2,4-5H,(H2,10,13) |
| InChIKey | XKFOMJYCPKFGTC-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.13 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |