C35H39NO5 — CID 174398005
tert-butyl formate;2-[4-[3-(naphthalen-2-ylmethoxy)piperidin-4-yl]phenoxy]-1-phenylethanone (PubChem CID 174398005) has the molecular formula C35H39NO5 and a molecular weight of 553.70 g/mol. Its IUPAC name is tert-butyl formate;2-[4-[3-(naphthalen-2-ylmethoxy)piperidin-4-yl]phenoxy]-1-phenylethanone.
| Compound Name | tert-butyl formate;2-[4-[3-(naphthalen-2-ylmethoxy)piperidin-4-yl]phenoxy]-1-phenylethanone |
|---|---|
| PubChem CID | 174398005 |
| Molecular Formula | C35H39NO5 |
| Molecular Weight | 553.70 g/mol |
| Exact Mass | 553.28 |
| IUPAC Name | tert-butyl formate;2-[4-[3-(naphthalen-2-ylmethoxy)piperidin-4-yl]phenoxy]-1-phenylethanone |
| SMILES | CC(C)(C)OC=O.O=C(COc1ccc(C2CCNCC2OCc2ccc3ccccc3c2)cc1)c1ccccc1 |
| InChI | InChI=1S/C30H29NO3.C5H10O2/c32-29(25-7-2-1-3-8-25)21-33-27-14-12-24(13-15-27)28-16-17-31-19-30(28)34-20-22-10-11-23-6-4-5-9-26(23)18-22;1-5(2,3)7-4-6/h1-15,18,28,30-31H,16-17,19-21H2;4H,1-3H3 |
| InChIKey | PSANEFLAFJOWON-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.70 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|