C22H33O4P — CID 174400566
3,3-dimethyl-2-[1-(2,4,6-trimethylbenzoyl)cyclohexyl]butanoic acid;oxophosphane (PubChem CID 174400566) has the molecular formula C22H33O4P and a molecular weight of 392.48 g/mol. Its IUPAC name is 3,3-dimethyl-2-[1-(2,4,6-trimethylbenzoyl)cyclohexyl]butanoic acid;oxophosphane.
| Compound Name | 3,3-dimethyl-2-[1-(2,4,6-trimethylbenzoyl)cyclohexyl]butanoic acid;oxophosphane |
|---|---|
| PubChem CID | 174400566 |
| Molecular Formula | C22H33O4P |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | 3,3-dimethyl-2-[1-(2,4,6-trimethylbenzoyl)cyclohexyl]butanoic acid;oxophosphane |
| SMILES | Cc1cc(C)c(C(=O)C2(C(C(=O)O)C(C)(C)C)CCCCC2)c(C)c1.O=P |
| InChI | InChI=1S/C22H32O3.HOP/c1-14-12-15(2)17(16(3)13-14)19(23)22(10-8-7-9-11-22)18(20(24)25)21(4,5)6;1-2/h12-13,18H,7-11H2,1-6H3,(H,24,25);2H |
| InChIKey | VSZAKNFDQCQVBV-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|