C5H6O7S — CID 174404330
2-methylidene-3-sulfobutanedioic acid (PubChem CID 174404330) has the molecular formula C5H6O7S and a molecular weight of 210.16 g/mol. Its IUPAC name is 2-methylidene-3-sulfobutanedioic acid.
| Compound Name | 2-methylidene-3-sulfobutanedioic acid |
|---|---|
| PubChem CID | 174404330 |
| Molecular Formula | C5H6O7S |
| Molecular Weight | 210.16 g/mol |
| Exact Mass | 209.98 |
| IUPAC Name | 2-methylidene-3-sulfobutanedioic acid |
| SMILES | C=C(C(=O)O)C(C(=O)O)S(=O)(=O)O |
| InChI | InChI=1S/C5H6O7S/c1-2(4(6)7)3(5(8)9)13(10,11)12/h3H,1H2,(H,6,7)(H,8,9)(H,10,11,12) |
| InChIKey | KUGOMTMCYOZJIH-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 128.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.16 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|