C4H6N2O7S — CID 174570131
3-(carbamoylamino)-3-oxo-2-sulfopropanoic acid (PubChem CID 174570131) has the molecular formula C4H6N2O7S and a molecular weight of 226.17 g/mol. Its IUPAC name is 3-(carbamoylamino)-3-oxo-2-sulfopropanoic acid.
| Compound Name | 3-(carbamoylamino)-3-oxo-2-sulfopropanoic acid |
|---|---|
| PubChem CID | 174570131 |
| Molecular Formula | C4H6N2O7S |
| Molecular Weight | 226.17 g/mol |
| Exact Mass | 225.99 |
| IUPAC Name | 3-(carbamoylamino)-3-oxo-2-sulfopropanoic acid |
| SMILES | NC(=O)NC(=O)C(C(=O)O)S(=O)(=O)O |
| InChI | InChI=1S/C4H6N2O7S/c5-4(10)6-2(7)1(3(8)9)14(11,12)13/h1H,(H,8,9)(H,11,12,13)(H3,5,6,7,10) |
| InChIKey | AEZDMQHRDDTBIQ-UHFFFAOYSA-N |
| XLogP | -2.48 |
| TPSA | 163.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.17 |
| LogP ≤ 5 | -2.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|