C8H14N2O4S — CID 64914905
3-[1-(carbamoylamino)-1-oxopropan-2-yl]sulfanyl-2-methylpropanoic acid (PubChem CID 64914905) has the molecular formula C8H14N2O4S and a molecular weight of 234.28 g/mol. Its IUPAC name is 3-[1-(carbamoylamino)-1-oxopropan-2-yl]sulfanyl-2-methylpropanoic acid.
| Compound Name | 3-[1-(carbamoylamino)-1-oxopropan-2-yl]sulfanyl-2-methylpropanoic acid |
|---|---|
| PubChem CID | 64914905 |
| Molecular Formula | C8H14N2O4S |
| Molecular Weight | 234.28 g/mol |
| Exact Mass | 234.07 |
| IUPAC Name | 3-[1-(carbamoylamino)-1-oxopropan-2-yl]sulfanyl-2-methylpropanoic acid |
| SMILES | CC(CSC(C)C(=O)NC(N)=O)C(=O)O |
| InChI | InChI=1S/C8H14N2O4S/c1-4(7(12)13)3-15-5(2)6(11)10-8(9)14/h4-5H,3H2,1-2H3,(H,12,13)(H3,9,10,11,14) |
| InChIKey | PJPODHRYBJCZFZ-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.28 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |