C7H13N3O2S2 — CID 9373253
[(2R)-1-(carbamoylamino)-1-oxopropan-2-yl] N,N-dimethylcarbamodithioate (PubChem CID 9373253) has the molecular formula C7H13N3O2S2 and a molecular weight of 235.33 g/mol. Its IUPAC name is [(2R)-1-(carbamoylamino)-1-oxopropan-2-yl] N,N-dimethylcarbamodithioate.
| Compound Name | [(2R)-1-(carbamoylamino)-1-oxopropan-2-yl] N,N-dimethylcarbamodithioate |
|---|---|
| PubChem CID | 9373253 |
| Molecular Formula | C7H13N3O2S2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.04 |
| IUPAC Name | [(2R)-1-(carbamoylamino)-1-oxopropan-2-yl] N,N-dimethylcarbamodithioate |
| SMILES | C[C@@H](SC(=S)N(C)C)C(=O)NC(N)=O |
| InChI | InChI=1S/C7H13N3O2S2/c1-4(5(11)9-6(8)12)14-7(13)10(2)3/h4H,1-3H3,(H3,8,9,11,12)/t4-/m1/s1 |
| InChIKey | GCPMTKPXEPFJBK-SCSAIBSYSA-N |
| XLogP | 0.15 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|