C9H15N3O2S2 — CID 40721301
[(2S)-1-(carbamoylamino)-1-oxopropan-2-yl] pyrrolidine-1-carbodithioate (PubChem CID 40721301) has the molecular formula C9H15N3O2S2 and a molecular weight of 261.37 g/mol. Its IUPAC name is [(2S)-1-(carbamoylamino)-1-oxopropan-2-yl] pyrrolidine-1-carbodithioate.
| Compound Name | [(2S)-1-(carbamoylamino)-1-oxopropan-2-yl] pyrrolidine-1-carbodithioate |
|---|---|
| PubChem CID | 40721301 |
| Molecular Formula | C9H15N3O2S2 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | [(2S)-1-(carbamoylamino)-1-oxopropan-2-yl] pyrrolidine-1-carbodithioate |
| SMILES | C[C@H](SC(=S)N1CCCC1)C(=O)NC(N)=O |
| InChI | InChI=1S/C9H15N3O2S2/c1-6(7(13)11-8(10)14)16-9(15)12-4-2-3-5-12/h6H,2-5H2,1H3,(H3,10,11,13,14)/t6-/m0/s1 |
| InChIKey | CAQNZTBSMZLSEJ-LURJTMIESA-N |
| XLogP | 0.68 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|