C19H27NO4 — CID 174404469
tert-butyl formate;methyl 4-(piperidin-4-ylidenemethyl)benzoate (PubChem CID 174404469) has the molecular formula C19H27NO4 and a molecular weight of 333.43 g/mol. Its IUPAC name is tert-butyl formate;methyl 4-(piperidin-4-ylidenemethyl)benzoate.
| Compound Name | tert-butyl formate;methyl 4-(piperidin-4-ylidenemethyl)benzoate |
|---|---|
| PubChem CID | 174404469 |
| Molecular Formula | C19H27NO4 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | tert-butyl formate;methyl 4-(piperidin-4-ylidenemethyl)benzoate |
| SMILES | CC(C)(C)OC=O.COC(=O)c1ccc(C=C2CCNCC2)cc1 |
| InChI | InChI=1S/C14H17NO2.C5H10O2/c1-17-14(16)13-4-2-11(3-5-13)10-12-6-8-15-9-7-12;1-5(2,3)7-4-6/h2-5,10,15H,6-9H2,1H3;4H,1-3H3 |
| InChIKey | KGQLSGHZKABOOA-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|