About lithium;bis(prop-1-enyl) carbonate;hydride
lithium;bis(prop-1-enyl) carbonate;hydride (PubChem CID 174406437) has the molecular formula C7H11LiO3
and a molecular weight of 150.10 g/mol. Its IUPAC name is lithium;bis(prop-1-enyl) carbonate;hydride.
Molecular Properties
| Compound Name | lithium;bis(prop-1-enyl) carbonate;hydride |
| PubChem CID | 174406437 |
| Molecular Formula | C7H11LiO3 |
| Molecular Weight | 150.10 g/mol |
| Exact Mass | 150.09 |
| IUPAC Name | lithium;bis(prop-1-enyl) carbonate;hydride |
| SMILES | CC=COC(=O)OC=CC.[H-].[Li+] |
| InChI | InChI=1S/C7H10O3.Li.H/c1-3-5-9-7(8)10-6-4-2;;/h3-6H,1-2H3;;/q;+1;-1 |
| InChIKey | KZWVSQTVUODGPZ-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.10 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze lithium;bis(prop-1-enyl) carbonate;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;bis(prop-1-enyl) carbonate;hydride?
The IUPAC name of lithium;bis(prop-1-enyl) carbonate;hydride (CID 174406437) is lithium;bis(prop-1-enyl) carbonate;hydride.
What is the SMILES notation for lithium;bis(prop-1-enyl) carbonate;hydride?
The canonical SMILES for lithium;bis(prop-1-enyl) carbonate;hydride is CC=COC(=O)OC=CC.[H-].[Li+].
What is the InChIKey of lithium;bis(prop-1-enyl) carbonate;hydride?
The InChIKey is KZWVSQTVUODGPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O3.Li.H/c1-3-5-9-7(8)10-6-4-2;;/h3-6H,1-2H3;;/q;+1;-1.
What are the key properties of lithium;bis(prop-1-enyl) carbonate;hydride?
lithium;bis(prop-1-enyl) carbonate;hydride has a molecular weight of 150.10 g/mol, XLogP of -0.68, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;bis(prop-1-enyl) carbonate;hydride is sourced from PubChem (CID 174406437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).