C11H20O6 — CID 174919373
bis(prop-1-enyl) carbonate;2-(2-hydroxyethoxy)ethanol (PubChem CID 174919373) has the molecular formula C11H20O6 and a molecular weight of 248.27 g/mol. Its IUPAC name is bis(prop-1-enyl) carbonate;2-(2-hydroxyethoxy)ethanol.
| Compound Name | bis(prop-1-enyl) carbonate;2-(2-hydroxyethoxy)ethanol |
|---|---|
| PubChem CID | 174919373 |
| Molecular Formula | C11H20O6 |
| Molecular Weight | 248.27 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | bis(prop-1-enyl) carbonate;2-(2-hydroxyethoxy)ethanol |
| SMILES | CC=COC(=O)OC=CC.OCCOCCO |
| InChI | InChI=1S/C7H10O3.C4H10O3/c1-3-5-9-7(8)10-6-4-2;5-1-3-7-4-2-6/h3-6H,1-2H3;5-6H,1-4H2 |
| InChIKey | QEMNRKGRRXUVGP-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.27 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|