C15H18ClO4S- — CID 174406761
[4-[(1R)-2-carboxy-1-cyclopentylethyl]-2-chlorophenyl]methanesulfinate (PubChem CID 174406761) has the molecular formula C15H18ClO4S- and a molecular weight of 329.83 g/mol. Its IUPAC name is [4-[(1R)-2-carboxy-1-cyclopentylethyl]-2-chlorophenyl]methanesulfinate.
| Compound Name | [4-[(1R)-2-carboxy-1-cyclopentylethyl]-2-chlorophenyl]methanesulfinate |
|---|---|
| PubChem CID | 174406761 |
| Molecular Formula | C15H18ClO4S- |
| Molecular Weight | 329.83 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | [4-[(1R)-2-carboxy-1-cyclopentylethyl]-2-chlorophenyl]methanesulfinate |
| SMILES | O=C(O)C[C@@H](c1ccc(CS(=O)[O-])c(Cl)c1)C1CCCC1 |
| InChI | InChI=1S/C15H19ClO4S/c16-14-7-11(5-6-12(14)9-21(19)20)13(8-15(17)18)10-3-1-2-4-10/h5-7,10,13H,1-4,8-9H2,(H,17,18)(H,19,20)/p-1/t13-/m1/s1 |
| InChIKey | RUTHYEPOTMYPSI-CYBMUJFWSA-M |
| XLogP | 3.47 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.83 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|