C21H17ClN4O3S — CID 174407474
1-(3-chloro-2-methylphenyl)-1-[4-cyano-2-(2-sulfamoylphenyl)phenyl]urea (PubChem CID 174407474) has the molecular formula C21H17ClN4O3S and a molecular weight of 440.91 g/mol. Its IUPAC name is 1-(3-chloro-2-methylphenyl)-1-[4-cyano-2-(2-sulfamoylphenyl)phenyl]urea.
| Compound Name | 1-(3-chloro-2-methylphenyl)-1-[4-cyano-2-(2-sulfamoylphenyl)phenyl]urea |
|---|---|
| PubChem CID | 174407474 |
| Molecular Formula | C21H17ClN4O3S |
| Molecular Weight | 440.91 g/mol |
| Exact Mass | 440.07 |
| IUPAC Name | 1-(3-chloro-2-methylphenyl)-1-[4-cyano-2-(2-sulfamoylphenyl)phenyl]urea |
| SMILES | Cc1c(Cl)cccc1N(C(N)=O)c1ccc(C#N)cc1-c1ccccc1S(N)(=O)=O |
| InChI | InChI=1S/C21H17ClN4O3S/c1-13-17(22)6-4-7-18(13)26(21(24)27)19-10-9-14(12-23)11-16(19)15-5-2-3-8-20(15)30(25,28)29/h2-11H,1H3,(H2,24,27)(H2,25,28,29) |
| InChIKey | ZMJHHTOTLSIUAY-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 130.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.91 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |