C18H19Cl2N3O2S — CID 174408003
N-[4-[(4-acetylpiperazin-1-yl)methyl]-3-chlorothiophen-2-yl]-N-(3-chlorophenyl)formamide (PubChem CID 174408003) has the molecular formula C18H19Cl2N3O2S and a molecular weight of 412.34 g/mol. Its IUPAC name is N-[4-[(4-acetylpiperazin-1-yl)methyl]-3-chlorothiophen-2-yl]-N-(3-chlorophenyl)formamide.
| Compound Name | N-[4-[(4-acetylpiperazin-1-yl)methyl]-3-chlorothiophen-2-yl]-N-(3-chlorophenyl)formamide |
|---|---|
| PubChem CID | 174408003 |
| Molecular Formula | C18H19Cl2N3O2S |
| Molecular Weight | 412.34 g/mol |
| Exact Mass | 411.06 |
| IUPAC Name | N-[4-[(4-acetylpiperazin-1-yl)methyl]-3-chlorothiophen-2-yl]-N-(3-chlorophenyl)formamide |
| SMILES | CC(=O)N1CCN(Cc2csc(N(C=O)c3cccc(Cl)c3)c2Cl)CC1 |
| InChI | InChI=1S/C18H19Cl2N3O2S/c1-13(25)22-7-5-21(6-8-22)10-14-11-26-18(17(14)20)23(12-24)16-4-2-3-15(19)9-16/h2-4,9,11-12H,5-8,10H2,1H3 |
| InChIKey | LJBIWIBWRQDHOQ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.34 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|