C10H10N2O6 — CID 174410606
methane;5-methanimidoyl-2-nitrobenzene-1,3-dicarboxylic acid (PubChem CID 174410606) has the molecular formula C10H10N2O6 and a molecular weight of 254.20 g/mol. Its IUPAC name is methane;5-methanimidoyl-2-nitrobenzene-1,3-dicarboxylic acid.
| Compound Name | methane;5-methanimidoyl-2-nitrobenzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 174410606 |
| Molecular Formula | C10H10N2O6 |
| Molecular Weight | 254.20 g/mol |
| Exact Mass | 254.05 |
| IUPAC Name | methane;5-methanimidoyl-2-nitrobenzene-1,3-dicarboxylic acid |
| SMILES | C.[H]/N=C/c1cc(C(=O)O)c([N+](=O)[O-])c(C(=O)O)c1 |
| InChI | InChI=1S/C9H6N2O6.CH4/c10-3-4-1-5(8(12)13)7(11(16)17)6(2-4)9(14)15;/h1-3,10H,(H,12,13)(H,14,15);1H4/b10-3+; |
| InChIKey | ZHTAHCQRUNZPFV-ORVWSRSGSA-N |
| XLogP | 1.62 |
| TPSA | 141.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.20 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|