C11H10N2O7S — CID 88759420
5-(dimethylcarbamoylsulfanyl)-2-nitrobenzene-1,3-dicarboxylic acid (PubChem CID 88759420) has the molecular formula C11H10N2O7S and a molecular weight of 314.28 g/mol. Its IUPAC name is 5-(dimethylcarbamoylsulfanyl)-2-nitrobenzene-1,3-dicarboxylic acid.
| Compound Name | 5-(dimethylcarbamoylsulfanyl)-2-nitrobenzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 88759420 |
| Molecular Formula | C11H10N2O7S |
| Molecular Weight | 314.28 g/mol |
| Exact Mass | 314.02 |
| IUPAC Name | 5-(dimethylcarbamoylsulfanyl)-2-nitrobenzene-1,3-dicarboxylic acid |
| SMILES | CN(C)C(=O)Sc1cc(C(=O)O)c([N+](=O)[O-])c(C(=O)O)c1 |
| InChI | InChI=1S/C11H10N2O7S/c1-12(2)11(18)21-5-3-6(9(14)15)8(13(19)20)7(4-5)10(16)17/h3-4H,1-2H3,(H,14,15)(H,16,17) |
| InChIKey | JVMUCFVMQDNLAX-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 138.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.28 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|