C14H20N4O4 — CID 174411632
1-(1-cyclohexyl-2-isocyanatobutyl)-1,3,5-triazinane-2,4,6-trione (PubChem CID 174411632) has the molecular formula C14H20N4O4 and a molecular weight of 308.34 g/mol. Its IUPAC name is 1-(1-cyclohexyl-2-isocyanatobutyl)-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1-(1-cyclohexyl-2-isocyanatobutyl)-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 174411632 |
| Molecular Formula | C14H20N4O4 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | 1-(1-cyclohexyl-2-isocyanatobutyl)-1,3,5-triazinane-2,4,6-trione |
| SMILES | CCC(N=C=O)C(C1CCCCC1)n1c(=O)[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C14H20N4O4/c1-2-10(15-8-19)11(9-6-4-3-5-7-9)18-13(21)16-12(20)17-14(18)22/h9-11H,2-7H2,1H3,(H2,16,17,20,21,22) |
| InChIKey | JOWHYBLFCRDFCJ-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 117.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|