C21H25ClN2O — CID 174413121
4-[[1-[(4-chlorophenyl)methyl]piperidin-4-ylidene]methyl]-N-ethoxycyclohexa-2,4-dien-1-imine (PubChem CID 174413121) has the molecular formula C21H25ClN2O and a molecular weight of 356.90 g/mol. Its IUPAC name is 4-[[1-[(4-chlorophenyl)methyl]piperidin-4-ylidene]methyl]-N-ethoxycyclohexa-2,4-dien-1-imine.
| Compound Name | 4-[[1-[(4-chlorophenyl)methyl]piperidin-4-ylidene]methyl]-N-ethoxycyclohexa-2,4-dien-1-imine |
|---|---|
| PubChem CID | 174413121 |
| Molecular Formula | C21H25ClN2O |
| Molecular Weight | 356.90 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | 4-[[1-[(4-chlorophenyl)methyl]piperidin-4-ylidene]methyl]-N-ethoxycyclohexa-2,4-dien-1-imine |
| SMILES | CCON=C1C=CC(C=C2CCN(Cc3ccc(Cl)cc3)CC2)=CC1 |
| InChI | InChI=1S/C21H25ClN2O/c1-2-25-23-21-9-5-17(6-10-21)15-18-11-13-24(14-12-18)16-19-3-7-20(22)8-4-19/h3-9,15H,2,10-14,16H2,1H3 |
| InChIKey | ILSNXGZTBGDVLA-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.90 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|