C18H17Cl2N — CID 177393308
(3E)-1-[(4-chlorophenyl)methyl]-3-[(4-chlorophenyl)methylidene]pyrrolidine (PubChem CID 177393308) has the molecular formula C18H17Cl2N and a molecular weight of 318.25 g/mol. Its IUPAC name is (3E)-1-[(4-chlorophenyl)methyl]-3-[(4-chlorophenyl)methylidene]pyrrolidine.
| Compound Name | (3E)-1-[(4-chlorophenyl)methyl]-3-[(4-chlorophenyl)methylidene]pyrrolidine |
|---|---|
| PubChem CID | 177393308 |
| Molecular Formula | C18H17Cl2N |
| Molecular Weight | 318.25 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | (3E)-1-[(4-chlorophenyl)methyl]-3-[(4-chlorophenyl)methylidene]pyrrolidine |
| SMILES | Clc1ccc(/C=C2\CCN(Cc3ccc(Cl)cc3)C2)cc1 |
| InChI | InChI=1S/C18H17Cl2N/c19-17-5-1-14(2-6-17)11-16-9-10-21(13-16)12-15-3-7-18(20)8-4-15/h1-8,11H,9-10,12-13H2/b16-11+ |
| InChIKey | SAASTZLQMOMAQN-LFIBNONCSA-N |
| XLogP | 5.28 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.25 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |