C18H28Cl2N2 — CID 174413272
1-(3,4-dichlorophenyl)-N-methyl-1-(1-pentylpiperidin-3-yl)methanamine (PubChem CID 174413272) has the molecular formula C18H28Cl2N2 and a molecular weight of 343.34 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-N-methyl-1-(1-pentylpiperidin-3-yl)methanamine.
| Compound Name | 1-(3,4-dichlorophenyl)-N-methyl-1-(1-pentylpiperidin-3-yl)methanamine |
|---|---|
| PubChem CID | 174413272 |
| Molecular Formula | C18H28Cl2N2 |
| Molecular Weight | 343.34 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-N-methyl-1-(1-pentylpiperidin-3-yl)methanamine |
| SMILES | CCCCCN1CCCC(C(NC)c2ccc(Cl)c(Cl)c2)C1 |
| InChI | InChI=1S/C18H28Cl2N2/c1-3-4-5-10-22-11-6-7-15(13-22)18(21-2)14-8-9-16(19)17(20)12-14/h8-9,12,15,18,21H,3-7,10-11,13H2,1-2H3 |
| InChIKey | QPEZGDMJDRWRDV-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.34 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|