C16H23Cl3N2 — CID 43308707
2,4,6-trichloro-N-[1-(1-propylpiperidin-3-yl)ethyl]aniline (PubChem CID 43308707) has the molecular formula C16H23Cl3N2 and a molecular weight of 349.73 g/mol. Its IUPAC name is 2,4,6-trichloro-N-[1-(1-propylpiperidin-3-yl)ethyl]aniline.
| Compound Name | 2,4,6-trichloro-N-[1-(1-propylpiperidin-3-yl)ethyl]aniline |
|---|---|
| PubChem CID | 43308707 |
| Molecular Formula | C16H23Cl3N2 |
| Molecular Weight | 349.73 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | 2,4,6-trichloro-N-[1-(1-propylpiperidin-3-yl)ethyl]aniline |
| SMILES | CCCN1CCCC(C(C)Nc2c(Cl)cc(Cl)cc2Cl)C1 |
| InChI | InChI=1S/C16H23Cl3N2/c1-3-6-21-7-4-5-12(10-21)11(2)20-16-14(18)8-13(17)9-15(16)19/h8-9,11-12,20H,3-7,10H2,1-2H3 |
| InChIKey | LNUMWOKAWDNYMT-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.73 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |