C15H22Cl2N2 — CID 43307449
2,5-dichloro-N-[1-(1-ethylpiperidin-3-yl)ethyl]aniline (PubChem CID 43307449) has the molecular formula C15H22Cl2N2 and a molecular weight of 301.26 g/mol. Its IUPAC name is 2,5-dichloro-N-[1-(1-ethylpiperidin-3-yl)ethyl]aniline.
| Compound Name | 2,5-dichloro-N-[1-(1-ethylpiperidin-3-yl)ethyl]aniline |
|---|---|
| PubChem CID | 43307449 |
| Molecular Formula | C15H22Cl2N2 |
| Molecular Weight | 301.26 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | 2,5-dichloro-N-[1-(1-ethylpiperidin-3-yl)ethyl]aniline |
| SMILES | CCN1CCCC(C(C)Nc2cc(Cl)ccc2Cl)C1 |
| InChI | InChI=1S/C15H22Cl2N2/c1-3-19-8-4-5-12(10-19)11(2)18-15-9-13(16)6-7-14(15)17/h6-7,9,11-12,18H,3-5,8,10H2,1-2H3 |
| InChIKey | IUQVKJVCQPQAPE-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.26 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |