C15H21BrF2N2 — CID 102853203
5-bromo-N-[1-(1-ethylpiperidin-3-yl)ethyl]-2,4-difluoroaniline (PubChem CID 102853203) has the molecular formula C15H21BrF2N2 and a molecular weight of 347.25 g/mol. Its IUPAC name is 5-bromo-N-[1-(1-ethylpiperidin-3-yl)ethyl]-2,4-difluoroaniline.
| Compound Name | 5-bromo-N-[1-(1-ethylpiperidin-3-yl)ethyl]-2,4-difluoroaniline |
|---|---|
| PubChem CID | 102853203 |
| Molecular Formula | C15H21BrF2N2 |
| Molecular Weight | 347.25 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | 5-bromo-N-[1-(1-ethylpiperidin-3-yl)ethyl]-2,4-difluoroaniline |
| SMILES | CCN1CCCC(C(C)Nc2cc(Br)c(F)cc2F)C1 |
| InChI | InChI=1S/C15H21BrF2N2/c1-3-20-6-4-5-11(9-20)10(2)19-15-7-12(16)13(17)8-14(15)18/h7-8,10-11,19H,3-6,9H2,1-2H3 |
| InChIKey | LEPYRZGSQHFPMX-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.25 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|