C16H25IN2 — CID 43716961
N-[1-(1-ethylpiperidin-3-yl)ethyl]-4-iodo-2-methylaniline (PubChem CID 43716961) has the molecular formula C16H25IN2 and a molecular weight of 372.29 g/mol. Its IUPAC name is N-[1-(1-ethylpiperidin-3-yl)ethyl]-4-iodo-2-methylaniline.
| Compound Name | N-[1-(1-ethylpiperidin-3-yl)ethyl]-4-iodo-2-methylaniline |
|---|---|
| PubChem CID | 43716961 |
| Molecular Formula | C16H25IN2 |
| Molecular Weight | 372.29 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | N-[1-(1-ethylpiperidin-3-yl)ethyl]-4-iodo-2-methylaniline |
| SMILES | CCN1CCCC(C(C)Nc2ccc(I)cc2C)C1 |
| InChI | InChI=1S/C16H25IN2/c1-4-19-9-5-6-14(11-19)13(3)18-16-8-7-15(17)10-12(16)2/h7-8,10,13-14,18H,4-6,9,11H2,1-3H3 |
| InChIKey | MIRBVKREZFHSOD-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.29 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|