C15H22ClIN2 — CID 107632479
4-chloro-N-[1-(1-ethylpiperidin-3-yl)ethyl]-2-iodoaniline (PubChem CID 107632479) has the molecular formula C15H22ClIN2 and a molecular weight of 392.71 g/mol. Its IUPAC name is 4-chloro-N-[1-(1-ethylpiperidin-3-yl)ethyl]-2-iodoaniline.
| Compound Name | 4-chloro-N-[1-(1-ethylpiperidin-3-yl)ethyl]-2-iodoaniline |
|---|---|
| PubChem CID | 107632479 |
| Molecular Formula | C15H22ClIN2 |
| Molecular Weight | 392.71 g/mol |
| Exact Mass | 392.05 |
| IUPAC Name | 4-chloro-N-[1-(1-ethylpiperidin-3-yl)ethyl]-2-iodoaniline |
| SMILES | CCN1CCCC(C(C)Nc2ccc(Cl)cc2I)C1 |
| InChI | InChI=1S/C15H22ClIN2/c1-3-19-8-4-5-12(10-19)11(2)18-15-7-6-13(16)9-14(15)17/h6-7,9,11-12,18H,3-5,8,10H2,1-2H3 |
| InChIKey | RJUQFBWTFWPLSR-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.71 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|