C16H16N2O4S2 — CID 174419304
3-[1-(3,5-dimethyl-1,2-oxazol-4-yl)prop-2-enylsulfonyl]-2H-1,3-benzothiazole-2-carbaldehyde (PubChem CID 174419304) has the molecular formula C16H16N2O4S2 and a molecular weight of 364.45 g/mol. Its IUPAC name is 3-[1-(3,5-dimethyl-1,2-oxazol-4-yl)prop-2-enylsulfonyl]-2H-1,3-benzothiazole-2-carbaldehyde.
| Compound Name | 3-[1-(3,5-dimethyl-1,2-oxazol-4-yl)prop-2-enylsulfonyl]-2H-1,3-benzothiazole-2-carbaldehyde |
|---|---|
| PubChem CID | 174419304 |
| Molecular Formula | C16H16N2O4S2 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.06 |
| IUPAC Name | 3-[1-(3,5-dimethyl-1,2-oxazol-4-yl)prop-2-enylsulfonyl]-2H-1,3-benzothiazole-2-carbaldehyde |
| SMILES | C=CC(c1c(C)noc1C)S(=O)(=O)N1c2ccccc2SC1C=O |
| InChI | InChI=1S/C16H16N2O4S2/c1-4-14(16-10(2)17-22-11(16)3)24(20,21)18-12-7-5-6-8-13(12)23-15(18)9-19/h4-9,14-15H,1H2,2-3H3 |
| InChIKey | YZJMXORGGBADOA-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 80.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|