C11H8F3NO — CID 174420328
3-[5-methyl-2-(trifluoromethyl)phenyl]-1,2-oxazole (PubChem CID 174420328) has the molecular formula C11H8F3NO and a molecular weight of 227.19 g/mol. Its IUPAC name is 3-[5-methyl-2-(trifluoromethyl)phenyl]-1,2-oxazole.
| Compound Name | 3-[5-methyl-2-(trifluoromethyl)phenyl]-1,2-oxazole |
|---|---|
| PubChem CID | 174420328 |
| Molecular Formula | C11H8F3NO |
| Molecular Weight | 227.19 g/mol |
| Exact Mass | 227.06 |
| IUPAC Name | 3-[5-methyl-2-(trifluoromethyl)phenyl]-1,2-oxazole |
| SMILES | Cc1ccc(C(F)(F)F)c(-c2ccon2)c1 |
| InChI | InChI=1S/C11H8F3NO/c1-7-2-3-9(11(12,13)14)8(6-7)10-4-5-16-15-10/h2-6H,1H3 |
| InChIKey | OHOBSJNBJPEBJI-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.19 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |