C13H11F3N2 — CID 116903677
4-(2,4-dimethylphenyl)-2-(trifluoromethyl)pyrimidine (PubChem CID 116903677) has the molecular formula C13H11F3N2 and a molecular weight of 252.24 g/mol. Its IUPAC name is 4-(2,4-dimethylphenyl)-2-(trifluoromethyl)pyrimidine.
| Compound Name | 4-(2,4-dimethylphenyl)-2-(trifluoromethyl)pyrimidine |
|---|---|
| PubChem CID | 116903677 |
| Molecular Formula | C13H11F3N2 |
| Molecular Weight | 252.24 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | 4-(2,4-dimethylphenyl)-2-(trifluoromethyl)pyrimidine |
| SMILES | Cc1ccc(-c2ccnc(C(F)(F)F)n2)c(C)c1 |
| InChI | InChI=1S/C13H11F3N2/c1-8-3-4-10(9(2)7-8)11-5-6-17-12(18-11)13(14,15)16/h3-7H,1-2H3 |
| InChIKey | ZGIWNPGDMXJPFV-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.24 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |