C17H23N — CID 176948420
6-(2,4-dimethylphenyl)-2,3-dimethylpyridine;ethane (PubChem CID 176948420) has the molecular formula C17H23N and a molecular weight of 241.38 g/mol. Its IUPAC name is 6-(2,4-dimethylphenyl)-2,3-dimethylpyridine;ethane.
| Compound Name | 6-(2,4-dimethylphenyl)-2,3-dimethylpyridine;ethane |
|---|---|
| PubChem CID | 176948420 |
| Molecular Formula | C17H23N |
| Molecular Weight | 241.38 g/mol |
| Exact Mass | 241.18 |
| IUPAC Name | 6-(2,4-dimethylphenyl)-2,3-dimethylpyridine;ethane |
| SMILES | CC.Cc1ccc(-c2ccc(C)c(C)n2)c(C)c1 |
| InChI | InChI=1S/C15H17N.C2H6/c1-10-5-7-14(12(3)9-10)15-8-6-11(2)13(4)16-15;1-2/h5-9H,1-4H3;1-2H3 |
| InChIKey | YTUVUAADADFDTO-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.38 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |