C15H17N3 — CID 82452571
6-(2,4-dimethylphenyl)-2-methylpyridine-3-carboximidamide (PubChem CID 82452571) has the molecular formula C15H17N3 and a molecular weight of 239.32 g/mol. Its IUPAC name is 6-(2,4-dimethylphenyl)-2-methylpyridine-3-carboximidamide.
| Compound Name | 6-(2,4-dimethylphenyl)-2-methylpyridine-3-carboximidamide |
|---|---|
| PubChem CID | 82452571 |
| Molecular Formula | C15H17N3 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.14 |
| IUPAC Name | 6-(2,4-dimethylphenyl)-2-methylpyridine-3-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(-c2ccc(C)cc2C)nc1C |
| InChI | InChI=1S/C15H17N3/c1-9-4-5-12(10(2)8-9)14-7-6-13(15(16)17)11(3)18-14/h4-8H,1-3H3,(H3,16,17) |
| InChIKey | CMHNOQDSCZPKSV-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 62.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|