C12H11BrN2 — CID 116904235
2-bromo-4-(2,4-dimethylphenyl)pyrimidine (PubChem CID 116904235) has the molecular formula C12H11BrN2 and a molecular weight of 263.14 g/mol. Its IUPAC name is 2-bromo-4-(2,4-dimethylphenyl)pyrimidine.
| Compound Name | 2-bromo-4-(2,4-dimethylphenyl)pyrimidine |
|---|---|
| PubChem CID | 116904235 |
| Molecular Formula | C12H11BrN2 |
| Molecular Weight | 263.14 g/mol |
| Exact Mass | 262.01 |
| IUPAC Name | 2-bromo-4-(2,4-dimethylphenyl)pyrimidine |
| SMILES | Cc1ccc(-c2ccnc(Br)n2)c(C)c1 |
| InChI | InChI=1S/C12H11BrN2/c1-8-3-4-10(9(2)7-8)11-5-6-14-12(13)15-11/h3-7H,1-2H3 |
| InChIKey | JGGNEBWTGWYGGZ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.14 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |