C49H86O3 — CID 174421880
bis(9-hept-5-enyl-9-methylhexadeca-2,14-dien-8-yl) carbonate (PubChem CID 174421880) has the molecular formula C49H86O3 and a molecular weight of 723.22 g/mol. Its IUPAC name is bis(9-hept-5-enyl-9-methylhexadeca-2,14-dien-8-yl) carbonate.
| Compound Name | bis(9-hept-5-enyl-9-methylhexadeca-2,14-dien-8-yl) carbonate |
|---|---|
| PubChem CID | 174421880 |
| Molecular Formula | C49H86O3 |
| Molecular Weight | 723.22 g/mol |
| Exact Mass | 722.66 |
| IUPAC Name | bis(9-hept-5-enyl-9-methylhexadeca-2,14-dien-8-yl) carbonate |
| SMILES | CC=CCCCCC(OC(=O)OC(CCCCC=CC)C(C)(CCCCC=CC)CCCCC=CC)C(C)(CCCCC=CC)CCCCC=CC |
| InChI | InChI=1S/C49H86O3/c1-9-15-21-27-33-39-45(48(7,41-35-29-23-17-11-3)42-36-30-24-18-12-4)51-47(50)52-46(40-34-28-22-16-10-2)49(8,43-37-31-25-19-13-5)44-38-32-26-20-14-6/h9-20,45-46H,21-44H2,1-8H3 |
| InChIKey | PRBOIEAFVXYIMF-UHFFFAOYSA-N |
| XLogP | 16.71 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.22 |
| LogP ≤ 5 | 16.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|