C18H34O3 — CID 156587701
[(E)-1-hydroxy-9,9-dimethyltetradec-12-enyl] acetate (PubChem CID 156587701) has the molecular formula C18H34O3 and a molecular weight of 298.47 g/mol. Its IUPAC name is [(E)-1-hydroxy-9,9-dimethyltetradec-12-enyl] acetate.
| Compound Name | [(E)-1-hydroxy-9,9-dimethyltetradec-12-enyl] acetate |
|---|---|
| PubChem CID | 156587701 |
| Molecular Formula | C18H34O3 |
| Molecular Weight | 298.47 g/mol |
| Exact Mass | 298.25 |
| IUPAC Name | [(E)-1-hydroxy-9,9-dimethyltetradec-12-enyl] acetate |
| SMILES | C/C=C/CCC(C)(C)CCCCCCCC(O)OC(C)=O |
| InChI | InChI=1S/C18H34O3/c1-5-6-11-14-18(3,4)15-12-9-7-8-10-13-17(20)21-16(2)19/h5-6,17,20H,7-15H2,1-4H3/b6-5+ |
| InChIKey | WEEPCQPCASXQBJ-AATRIKPKSA-N |
| XLogP | 4.98 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.47 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|