C13H12N6O3S — CID 17442210
N'-[2-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)sulfanylacetyl]furan-2-carbohydrazide (PubChem CID 17442210) has the molecular formula C13H12N6O3S and a molecular weight of 332.35 g/mol. Its IUPAC name is N'-[2-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)sulfanylacetyl]furan-2-carbohydrazide.
| Compound Name | N'-[2-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)sulfanylacetyl]furan-2-carbohydrazide |
|---|---|
| PubChem CID | 17442210 |
| Molecular Formula | C13H12N6O3S |
| Molecular Weight | 332.35 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | N'-[2-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)sulfanylacetyl]furan-2-carbohydrazide |
| SMILES | Cn1ncc2c(SCC(=O)NNC(=O)c3ccco3)ncnc21 |
| InChI | InChI=1S/C13H12N6O3S/c1-19-11-8(5-16-19)13(15-7-14-11)23-6-10(20)17-18-12(21)9-3-2-4-22-9/h2-5,7H,6H2,1H3,(H,17,20)(H,18,21) |
| InChIKey | OQHNKQDRIBBKQE-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 114.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.35 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|