About methyl 2-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)sulfanylacetate
methyl 2-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)sulfanylacetate (PubChem CID 42103957) has the molecular formula C9H10N4O2S
and a molecular weight of 238.27 g/mol. Its IUPAC name is methyl 2-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)sulfanylacetate.
Analyze methyl 2-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)sulfanylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)sulfanylacetate?
The IUPAC name of methyl 2-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)sulfanylacetate (CID 42103957) is methyl 2-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)sulfanylacetate.
What is the SMILES notation for methyl 2-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)sulfanylacetate?
The canonical SMILES for methyl 2-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)sulfanylacetate is COC(=O)CSc1ncnc2c1cnn2C.
What is the InChIKey of methyl 2-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)sulfanylacetate?
The InChIKey is DJLSXPIPMHWGOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N4O2S/c1-13-8-6(3-12-13)9(11-5-10-8)16-4-7(14)15-2/h3,5H,4H2,1-2H3.
What are the key properties of methyl 2-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)sulfanylacetate?
methyl 2-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)sulfanylacetate has a molecular weight of 238.27 g/mol, XLogP of 0.63, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)sulfanylacetate is sourced from PubChem (CID 42103957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).