C16H14Cl2N2S — CID 174425441
1-[2-[2-chloro-4-(5-chlorothiophen-2-yl)phenyl]ethyl]-2-methylimidazole (PubChem CID 174425441) has the molecular formula C16H14Cl2N2S and a molecular weight of 337.28 g/mol. Its IUPAC name is 1-[2-[2-chloro-4-(5-chlorothiophen-2-yl)phenyl]ethyl]-2-methylimidazole.
| Compound Name | 1-[2-[2-chloro-4-(5-chlorothiophen-2-yl)phenyl]ethyl]-2-methylimidazole |
|---|---|
| PubChem CID | 174425441 |
| Molecular Formula | C16H14Cl2N2S |
| Molecular Weight | 337.28 g/mol |
| Exact Mass | 336.03 |
| IUPAC Name | 1-[2-[2-chloro-4-(5-chlorothiophen-2-yl)phenyl]ethyl]-2-methylimidazole |
| SMILES | Cc1nccn1CCc1ccc(-c2ccc(Cl)s2)cc1Cl |
| InChI | InChI=1S/C16H14Cl2N2S/c1-11-19-7-9-20(11)8-6-12-2-3-13(10-14(12)17)15-4-5-16(18)21-15/h2-5,7,9-10H,6,8H2,1H3 |
| InChIKey | YNEDMKOFCBLYQC-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.28 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |