C25H35N2O6P — CID 174426163
(2S)-2-[methyl-[(2S)-4-methyl-2-[(3-phenyl-1-phosphonopropyl)amino]pentanoyl]amino]-3-phenylpropanoic acid (PubChem CID 174426163) has the molecular formula C25H35N2O6P and a molecular weight of 490.54 g/mol. Its IUPAC name is (2S)-2-[methyl-[(2S)-4-methyl-2-[(3-phenyl-1-phosphonopropyl)amino]pentanoyl]amino]-3-phenylpropanoic acid.
| Compound Name | (2S)-2-[methyl-[(2S)-4-methyl-2-[(3-phenyl-1-phosphonopropyl)amino]pentanoyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 174426163 |
| Molecular Formula | C25H35N2O6P |
| Molecular Weight | 490.54 g/mol |
| Exact Mass | 490.22 |
| IUPAC Name | (2S)-2-[methyl-[(2S)-4-methyl-2-[(3-phenyl-1-phosphonopropyl)amino]pentanoyl]amino]-3-phenylpropanoic acid |
| SMILES | CC(C)C[C@H](NC(CCc1ccccc1)P(=O)(O)O)C(=O)N(C)[C@@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C25H35N2O6P/c1-18(2)16-21(26-23(34(31,32)33)15-14-19-10-6-4-7-11-19)24(28)27(3)22(25(29)30)17-20-12-8-5-9-13-20/h4-13,18,21-23,26H,14-17H2,1-3H3,(H,29,30)(H2,31,32,33)/t21-,22-,23?/m0/s1 |
| InChIKey | ZAGWWHOLIYMSOF-OJSMNCEXSA-N |
| XLogP | 3.28 |
| TPSA | 127.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.54 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|