About 1-phenylethyl 2-methylpropanoate;2-phenylethyl 2-methylpropanoate
1-phenylethyl 2-methylpropanoate;2-phenylethyl 2-methylpropanoate (PubChem CID 174429425) has the molecular formula C24H32O4
and a molecular weight of 384.52 g/mol. Its IUPAC name is 1-phenylethyl 2-methylpropanoate;2-phenylethyl 2-methylpropanoate.
Molecular Properties
| Compound Name | 1-phenylethyl 2-methylpropanoate;2-phenylethyl 2-methylpropanoate |
| PubChem CID | 174429425 |
| Molecular Formula | C24H32O4 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.23 |
| IUPAC Name | 1-phenylethyl 2-methylpropanoate;2-phenylethyl 2-methylpropanoate |
| SMILES | CC(C)C(=O)OC(C)c1ccccc1.CC(C)C(=O)OCCc1ccccc1 |
| InChI | InChI=1S/2C12H16O2/c1-9(2)12(13)14-10(3)11-7-5-4-6-8-11;1-10(2)12(13)14-9-8-11-6-4-3-5-7-11/h4-10H,1-3H3;3-7,10H,8-9H2,1-2H3 |
| InChIKey | QWPHICRPFFBAQH-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-phenylethyl 2-methylpropanoate;2-phenylethyl 2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenylethyl 2-methylpropanoate;2-phenylethyl 2-methylpropanoate?
The IUPAC name of 1-phenylethyl 2-methylpropanoate;2-phenylethyl 2-methylpropanoate (CID 174429425) is 1-phenylethyl 2-methylpropanoate;2-phenylethyl 2-methylpropanoate.
What is the SMILES notation for 1-phenylethyl 2-methylpropanoate;2-phenylethyl 2-methylpropanoate?
The canonical SMILES for 1-phenylethyl 2-methylpropanoate;2-phenylethyl 2-methylpropanoate is CC(C)C(=O)OC(C)c1ccccc1.CC(C)C(=O)OCCc1ccccc1.
What is the InChIKey of 1-phenylethyl 2-methylpropanoate;2-phenylethyl 2-methylpropanoate?
The InChIKey is QWPHICRPFFBAQH-UHFFFAOYSA-N. The full InChI is InChI=1S/2C12H16O2/c1-9(2)12(13)14-10(3)11-7-5-4-6-8-11;1-10(2)12(13)14-9-8-11-6-4-3-5-7-11/h4-10H,1-3H3;3-7,10H,8-9H2,1-2H3.
What are the key properties of 1-phenylethyl 2-methylpropanoate;2-phenylethyl 2-methylpropanoate?
1-phenylethyl 2-methylpropanoate;2-phenylethyl 2-methylpropanoate has a molecular weight of 384.52 g/mol, XLogP of 5.38, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenylethyl 2-methylpropanoate;2-phenylethyl 2-methylpropanoate is sourced from PubChem (CID 174429425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).