C22H25FN4O2 — CID 174432932
7-(4-ethylpiperazine-1-carbonyl)-1H-indole-3-carboxamide;fluorobenzene (PubChem CID 174432932) has the molecular formula C22H25FN4O2 and a molecular weight of 396.47 g/mol. Its IUPAC name is 7-(4-ethylpiperazine-1-carbonyl)-1H-indole-3-carboxamide;fluorobenzene.
| Compound Name | 7-(4-ethylpiperazine-1-carbonyl)-1H-indole-3-carboxamide;fluorobenzene |
|---|---|
| PubChem CID | 174432932 |
| Molecular Formula | C22H25FN4O2 |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | 7-(4-ethylpiperazine-1-carbonyl)-1H-indole-3-carboxamide;fluorobenzene |
| SMILES | CCN1CCN(C(=O)c2cccc3c(C(N)=O)c[nH]c23)CC1.Fc1ccccc1 |
| InChI | InChI=1S/C16H20N4O2.C6H5F/c1-2-19-6-8-20(9-7-19)16(22)12-5-3-4-11-13(15(17)21)10-18-14(11)12;7-6-4-2-1-3-5-6/h3-5,10,18H,2,6-9H2,1H3,(H2,17,21);1-5H |
| InChIKey | FHOHFFKXZLISIV-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |