C20H39N3O4 — CID 174434292
1,5-diamino-3-(2-aminoacetyl)-3-(5-octoxypentyl)pentane-2,4-dione (PubChem CID 174434292) has the molecular formula C20H39N3O4 and a molecular weight of 385.55 g/mol. Its IUPAC name is 1,5-diamino-3-(2-aminoacetyl)-3-(5-octoxypentyl)pentane-2,4-dione.
| Compound Name | 1,5-diamino-3-(2-aminoacetyl)-3-(5-octoxypentyl)pentane-2,4-dione |
|---|---|
| PubChem CID | 174434292 |
| Molecular Formula | C20H39N3O4 |
| Molecular Weight | 385.55 g/mol |
| Exact Mass | 385.29 |
| IUPAC Name | 1,5-diamino-3-(2-aminoacetyl)-3-(5-octoxypentyl)pentane-2,4-dione |
| SMILES | CCCCCCCCOCCCCCC(C(=O)CN)(C(=O)CN)C(=O)CN |
| InChI | InChI=1S/C20H39N3O4/c1-2-3-4-5-6-9-12-27-13-10-7-8-11-20(17(24)14-21,18(25)15-22)19(26)16-23/h2-16,21-23H2,1H3 |
| InChIKey | GFTAORVWNWHXPJ-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 138.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.55 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|