C16H31N3O4 — CID 174419993
1,5-diamino-3-(2-aminoacetyl)-3-(3-hexoxypropyl)pentane-2,4-dione (PubChem CID 174419993) has the molecular formula C16H31N3O4 and a molecular weight of 329.44 g/mol. Its IUPAC name is 1,5-diamino-3-(2-aminoacetyl)-3-(3-hexoxypropyl)pentane-2,4-dione.
| Compound Name | 1,5-diamino-3-(2-aminoacetyl)-3-(3-hexoxypropyl)pentane-2,4-dione |
|---|---|
| PubChem CID | 174419993 |
| Molecular Formula | C16H31N3O4 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.23 |
| IUPAC Name | 1,5-diamino-3-(2-aminoacetyl)-3-(3-hexoxypropyl)pentane-2,4-dione |
| SMILES | CCCCCCOCCCC(C(=O)CN)(C(=O)CN)C(=O)CN |
| InChI | InChI=1S/C16H31N3O4/c1-2-3-4-5-8-23-9-6-7-16(13(20)10-17,14(21)11-18)15(22)12-19/h2-12,17-19H2,1H3 |
| InChIKey | JBHHVZCHUKBQKC-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 138.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|