About dichlorozirconium;phenylsilylmethanamine
dichlorozirconium;phenylsilylmethanamine (PubChem CID 174434532) has the molecular formula C7H11Cl2NSiZr
and a molecular weight of 299.39 g/mol. Its IUPAC name is dichlorozirconium;phenylsilylmethanamine.
Molecular Properties
| Compound Name | dichlorozirconium;phenylsilylmethanamine |
| PubChem CID | 174434532 |
| Molecular Formula | C7H11Cl2NSiZr |
| Molecular Weight | 299.39 g/mol |
| Exact Mass | 296.91 |
| IUPAC Name | dichlorozirconium;phenylsilylmethanamine |
| SMILES | Cl[Zr]Cl.NC[SiH2]c1ccccc1 |
| InChI | InChI=1S/C7H11NSi.2ClH.Zr/c8-6-9-7-4-2-1-3-5-7;;;/h1-5H,6,8-9H2;2*1H;/q;;;+2/p-2 |
| InChIKey | FDWOJLLEBWEKFP-UHFFFAOYSA-L |
| XLogP | 0.77 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.39 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dichlorozirconium;phenylsilylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichlorozirconium;phenylsilylmethanamine?
The IUPAC name of dichlorozirconium;phenylsilylmethanamine (CID 174434532) is dichlorozirconium;phenylsilylmethanamine.
What is the SMILES notation for dichlorozirconium;phenylsilylmethanamine?
The canonical SMILES for dichlorozirconium;phenylsilylmethanamine is Cl[Zr]Cl.NC[SiH2]c1ccccc1.
What is the InChIKey of dichlorozirconium;phenylsilylmethanamine?
The InChIKey is FDWOJLLEBWEKFP-UHFFFAOYSA-L. The full InChI is InChI=1S/C7H11NSi.2ClH.Zr/c8-6-9-7-4-2-1-3-5-7;;;/h1-5H,6,8-9H2;2*1H;/q;;;+2/p-2.
What are the key properties of dichlorozirconium;phenylsilylmethanamine?
dichlorozirconium;phenylsilylmethanamine has a molecular weight of 299.39 g/mol, XLogP of 0.77, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dichlorozirconium;phenylsilylmethanamine is sourced from PubChem (CID 174434532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).