C17H11Cl2NO3 — CID 174434583
(2-benzoyl-4,5-dichloro-1H-indol-3-yl) acetate (PubChem CID 174434583) has the molecular formula C17H11Cl2NO3 and a molecular weight of 348.19 g/mol. Its IUPAC name is (2-benzoyl-4,5-dichloro-1H-indol-3-yl) acetate.
| Compound Name | (2-benzoyl-4,5-dichloro-1H-indol-3-yl) acetate |
|---|---|
| PubChem CID | 174434583 |
| Molecular Formula | C17H11Cl2NO3 |
| Molecular Weight | 348.19 g/mol |
| Exact Mass | 347.01 |
| IUPAC Name | (2-benzoyl-4,5-dichloro-1H-indol-3-yl) acetate |
| SMILES | CC(=O)Oc1c(C(=O)c2ccccc2)[nH]c2ccc(Cl)c(Cl)c12 |
| InChI | InChI=1S/C17H11Cl2NO3/c1-9(21)23-17-13-12(8-7-11(18)14(13)19)20-15(17)16(22)10-5-3-2-4-6-10/h2-8,20H,1H3 |
| InChIKey | ACORZEYTNSHNFM-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.19 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |