About benzoic acid;2-fluoro-4-methylpyridine
benzoic acid;2-fluoro-4-methylpyridine (PubChem CID 174435105) has the molecular formula C13H12FNO2
and a molecular weight of 233.24 g/mol. Its IUPAC name is benzoic acid;2-fluoro-4-methylpyridine.
Molecular Properties
| Compound Name | benzoic acid;2-fluoro-4-methylpyridine |
| PubChem CID | 174435105 |
| Molecular Formula | C13H12FNO2 |
| Molecular Weight | 233.24 g/mol |
| Exact Mass | 233.09 |
| IUPAC Name | benzoic acid;2-fluoro-4-methylpyridine |
| SMILES | Cc1ccnc(F)c1.O=C(O)c1ccccc1 |
| InChI | InChI=1S/C7H6O2.C6H6FN/c8-7(9)6-4-2-1-3-5-6;1-5-2-3-8-6(7)4-5/h1-5H,(H,8,9);2-4H,1H3 |
| InChIKey | VOUUSEXVFHWIFI-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.24 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze benzoic acid;2-fluoro-4-methylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzoic acid;2-fluoro-4-methylpyridine?
The IUPAC name of benzoic acid;2-fluoro-4-methylpyridine (CID 174435105) is benzoic acid;2-fluoro-4-methylpyridine.
What is the SMILES notation for benzoic acid;2-fluoro-4-methylpyridine?
The canonical SMILES for benzoic acid;2-fluoro-4-methylpyridine is Cc1ccnc(F)c1.O=C(O)c1ccccc1.
What is the InChIKey of benzoic acid;2-fluoro-4-methylpyridine?
The InChIKey is VOUUSEXVFHWIFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O2.C6H6FN/c8-7(9)6-4-2-1-3-5-6;1-5-2-3-8-6(7)4-5/h1-5H,(H,8,9);2-4H,1H3.
What are the key properties of benzoic acid;2-fluoro-4-methylpyridine?
benzoic acid;2-fluoro-4-methylpyridine has a molecular weight of 233.24 g/mol, XLogP of 2.91, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzoic acid;2-fluoro-4-methylpyridine is sourced from PubChem (CID 174435105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).