About (2-hydroxyphenyl)sulfonyl 7-oxopentadecanoate
(2-hydroxyphenyl)sulfonyl 7-oxopentadecanoate (PubChem CID 174435767) has the molecular formula C21H32O6S
and a molecular weight of 412.55 g/mol. Its IUPAC name is (2-hydroxyphenyl)sulfonyl 7-oxopentadecanoate.
Molecular Properties
| Compound Name | (2-hydroxyphenyl)sulfonyl 7-oxopentadecanoate |
| PubChem CID | 174435767 |
| Molecular Formula | C21H32O6S |
| Molecular Weight | 412.55 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | (2-hydroxyphenyl)sulfonyl 7-oxopentadecanoate |
| SMILES | CCCCCCCCC(=O)CCCCCC(=O)OS(=O)(=O)c1ccccc1O |
| InChI | InChI=1S/C21H32O6S/c1-2-3-4-5-6-8-13-18(22)14-9-7-10-17-21(24)27-28(25,26)20-16-12-11-15-19(20)23/h11-12,15-16,23H,2-10,13-14,17H2,1H3 |
| InChIKey | DWMGJJKWOYVTDG-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 412.55 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (2-hydroxyphenyl)sulfonyl 7-oxopentadecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-hydroxyphenyl)sulfonyl 7-oxopentadecanoate?
The IUPAC name of (2-hydroxyphenyl)sulfonyl 7-oxopentadecanoate (CID 174435767) is (2-hydroxyphenyl)sulfonyl 7-oxopentadecanoate.
What is the SMILES notation for (2-hydroxyphenyl)sulfonyl 7-oxopentadecanoate?
The canonical SMILES for (2-hydroxyphenyl)sulfonyl 7-oxopentadecanoate is CCCCCCCCC(=O)CCCCCC(=O)OS(=O)(=O)c1ccccc1O.
What is the InChIKey of (2-hydroxyphenyl)sulfonyl 7-oxopentadecanoate?
The InChIKey is DWMGJJKWOYVTDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H32O6S/c1-2-3-4-5-6-8-13-18(22)14-9-7-10-17-21(24)27-28(25,26)20-16-12-11-15-19(20)23/h11-12,15-16,23H,2-10,13-14,17H2,1H3.
What are the key properties of (2-hydroxyphenyl)sulfonyl 7-oxopentadecanoate?
(2-hydroxyphenyl)sulfonyl 7-oxopentadecanoate has a molecular weight of 412.55 g/mol, XLogP of 4.89, 15 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2-hydroxyphenyl)sulfonyl 7-oxopentadecanoate is sourced from PubChem (CID 174435767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).