C15H31NO3 — CID 174436433
tert-butyl carbamate;(4-propylcyclohexyl)methanol (PubChem CID 174436433) has the molecular formula C15H31NO3 and a molecular weight of 273.42 g/mol. Its IUPAC name is tert-butyl carbamate;(4-propylcyclohexyl)methanol.
| Compound Name | tert-butyl carbamate;(4-propylcyclohexyl)methanol |
|---|---|
| PubChem CID | 174436433 |
| Molecular Formula | C15H31NO3 |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.23 |
| IUPAC Name | tert-butyl carbamate;(4-propylcyclohexyl)methanol |
| SMILES | CC(C)(C)OC(N)=O.CCCC1CCC(CO)CC1 |
| InChI | InChI=1S/C10H20O.C5H11NO2/c1-2-3-9-4-6-10(8-11)7-5-9;1-5(2,3)8-4(6)7/h9-11H,2-8H2,1H3;1-3H3,(H2,6,7) |
| InChIKey | SDUHVRASXTTWAE-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |